C14H11FO — CID 151716486
1-(2-fluorophenyl)-1,3-dihydro-2-benzofuran (PubChem CID 151716486) has the molecular formula C14H11FO and a molecular weight of 214.24 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-1,3-dihydro-2-benzofuran.
| Compound Name | 1-(2-fluorophenyl)-1,3-dihydro-2-benzofuran |
|---|---|
| PubChem CID | 151716486 |
| Molecular Formula | C14H11FO |
| Molecular Weight | 214.24 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 1-(2-fluorophenyl)-1,3-dihydro-2-benzofuran |
| SMILES | Fc1ccccc1C1OCc2ccccc21 |
| InChI | InChI=1S/C14H11FO/c15-13-8-4-3-7-12(13)14-11-6-2-1-5-10(11)9-16-14/h1-8,14H,9H2 |
| InChIKey | RHRDENOGKIQEJR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.24 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |