C16H12O — CID 91350887
5,6a-dihydroindeno[1,2-c]isochromene (PubChem CID 91350887) has the molecular formula C16H12O and a molecular weight of 220.27 g/mol. Its IUPAC name is 5,6a-dihydroindeno[1,2-c]isochromene.
| Compound Name | 5,6a-dihydroindeno[1,2-c]isochromene |
|---|---|
| PubChem CID | 91350887 |
| Molecular Formula | C16H12O |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 5,6a-dihydroindeno[1,2-c]isochromene |
| SMILES | C1=C2c3ccccc3COC2c2ccccc21 |
| InChI | InChI=1S/C16H12O/c1-4-8-14-11(5-1)9-15-13-7-3-2-6-12(13)10-17-16(14)15/h1-9,16H,10H2 |
| InChIKey | TUXFZCZNHHFOOZ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|