C17H22O — CID 132557633
(5S,8R)-4,4,8-trimethyl-9-oxatricyclo[9.4.0.02,5]pentadeca-1(15),2,11,13-tetraene (PubChem CID 132557633) has the molecular formula C17H22O and a molecular weight of 242.36 g/mol. Its IUPAC name is (5S,8R)-4,4,8-trimethyl-9-oxatricyclo[9.4.0.02,5]pentadeca-1(15),2,11,13-tetraene.
| Compound Name | (5S,8R)-4,4,8-trimethyl-9-oxatricyclo[9.4.0.02,5]pentadeca-1(15),2,11,13-tetraene |
|---|---|
| PubChem CID | 132557633 |
| Molecular Formula | C17H22O |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | (5S,8R)-4,4,8-trimethyl-9-oxatricyclo[9.4.0.02,5]pentadeca-1(15),2,11,13-tetraene |
| SMILES | C[C@@H]1CC[C@@H]2C(=CC2(C)C)c2ccccc2CO1 |
| InChI | InChI=1S/C17H22O/c1-12-8-9-16-15(10-17(16,2)3)14-7-5-4-6-13(14)11-18-12/h4-7,10,12,16H,8-9,11H2,1-3H3/t12-,16-/m1/s1 |
| InChIKey | YIZGMBFYIUMDSM-MLGOLLRUSA-N |
| XLogP | 4.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |