About (2'R)-2'-methylspiro[1,3-dihydroindene-2,4'-oxolane]
(2'R)-2'-methylspiro[1,3-dihydroindene-2,4'-oxolane] (PubChem CID 166439861) has the molecular formula C13H16O
and a molecular weight of 188.27 g/mol. Its IUPAC name is (2'R)-2'-methylspiro[1,3-dihydroindene-2,4'-oxolane].
Molecular Properties
| Compound Name | (2'R)-2'-methylspiro[1,3-dihydroindene-2,4'-oxolane] |
| PubChem CID | 166439861 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | (2'R)-2'-methylspiro[1,3-dihydroindene-2,4'-oxolane] |
| SMILES | C[C@@H]1CC2(CO1)Cc1ccccc1C2 |
| InChI | InChI=1S/C13H16O/c1-10-6-13(9-14-10)7-11-4-2-3-5-12(11)8-13/h2-5,10H,6-9H2,1H3/t10-/m1/s1 |
| InChIKey | DEBOKAMXDURVDF-SNVBAGLBSA-N |
| XLogP | 2.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2'R)-2'-methylspiro[1,3-dihydroindene-2,4'-oxolane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2'R)-2'-methylspiro[1,3-dihydroindene-2,4'-oxolane]?
The IUPAC name of (2'R)-2'-methylspiro[1,3-dihydroindene-2,4'-oxolane] (CID 166439861) is (2'R)-2'-methylspiro[1,3-dihydroindene-2,4'-oxolane].
What is the SMILES notation for (2'R)-2'-methylspiro[1,3-dihydroindene-2,4'-oxolane]?
The canonical SMILES for (2'R)-2'-methylspiro[1,3-dihydroindene-2,4'-oxolane] is C[C@@H]1CC2(CO1)Cc1ccccc1C2.
What is the InChIKey of (2'R)-2'-methylspiro[1,3-dihydroindene-2,4'-oxolane]?
The InChIKey is DEBOKAMXDURVDF-SNVBAGLBSA-N. The full InChI is InChI=1S/C13H16O/c1-10-6-13(9-14-10)7-11-4-2-3-5-12(11)8-13/h2-5,10H,6-9H2,1H3/t10-/m1/s1.
What are the key properties of (2'R)-2'-methylspiro[1,3-dihydroindene-2,4'-oxolane]?
(2'R)-2'-methylspiro[1,3-dihydroindene-2,4'-oxolane] has a molecular weight of 188.27 g/mol, XLogP of 2.58, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2'R)-2'-methylspiro[1,3-dihydroindene-2,4'-oxolane] is sourced from PubChem (CID 166439861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).