C13H14OS2 — CID 155934701
(2S)-2-methyl-4,4-dithiophen-2-yloxolane (PubChem CID 155934701) has the molecular formula C13H14OS2 and a molecular weight of 250.39 g/mol. Its IUPAC name is (2S)-2-methyl-4,4-dithiophen-2-yloxolane.
| Compound Name | (2S)-2-methyl-4,4-dithiophen-2-yloxolane |
|---|---|
| PubChem CID | 155934701 |
| Molecular Formula | C13H14OS2 |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | (2S)-2-methyl-4,4-dithiophen-2-yloxolane |
| SMILES | C[C@H]1CC(c2cccs2)(c2cccs2)CO1 |
| InChI | InChI=1S/C13H14OS2/c1-10-8-13(9-14-10,11-4-2-6-15-11)12-5-3-7-16-12/h2-7,10H,8-9H2,1H3/t10-/m0/s1 |
| InChIKey | IDZFBGPBADCGPQ-JTQLQIEISA-N |
| XLogP | 3.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |