About (2S)-2-methyl-4,4-dithiophen-2-yloxolane
(2S)-2-methyl-4,4-dithiophen-2-yloxolane (PubChem CID 155934701) has the molecular formula C13H14OS2
and a molecular weight of 250.39 g/mol. Its IUPAC name is (2S)-2-methyl-4,4-dithiophen-2-yloxolane.
Molecular Properties
| Compound Name | (2S)-2-methyl-4,4-dithiophen-2-yloxolane |
| PubChem CID | 155934701 |
| Molecular Formula | C13H14OS2 |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | (2S)-2-methyl-4,4-dithiophen-2-yloxolane |
| SMILES | C[C@H]1CC(c2cccs2)(c2cccs2)CO1 |
| InChI | InChI=1S/C13H14OS2/c1-10-8-13(9-14-10,11-4-2-6-15-11)12-5-3-7-16-12/h2-7,10H,8-9H2,1H3/t10-/m0/s1 |
| InChIKey | IDZFBGPBADCGPQ-JTQLQIEISA-N |
| XLogP | 3.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-methyl-4,4-dithiophen-2-yloxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-methyl-4,4-dithiophen-2-yloxolane?
The IUPAC name of (2S)-2-methyl-4,4-dithiophen-2-yloxolane (CID 155934701) is (2S)-2-methyl-4,4-dithiophen-2-yloxolane.
What is the SMILES notation for (2S)-2-methyl-4,4-dithiophen-2-yloxolane?
The canonical SMILES for (2S)-2-methyl-4,4-dithiophen-2-yloxolane is C[C@H]1CC(c2cccs2)(c2cccs2)CO1.
What is the InChIKey of (2S)-2-methyl-4,4-dithiophen-2-yloxolane?
The InChIKey is IDZFBGPBADCGPQ-JTQLQIEISA-N. The full InChI is InChI=1S/C13H14OS2/c1-10-8-13(9-14-10,11-4-2-6-15-11)12-5-3-7-16-12/h2-7,10H,8-9H2,1H3/t10-/m0/s1.
What are the key properties of (2S)-2-methyl-4,4-dithiophen-2-yloxolane?
(2S)-2-methyl-4,4-dithiophen-2-yloxolane has a molecular weight of 250.39 g/mol, XLogP of 3.90, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-methyl-4,4-dithiophen-2-yloxolane is sourced from PubChem (CID 155934701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).