C8H8O2S — CID 141238164
2-methyl-2-thiophen-2-yl-1,3-dioxole (PubChem CID 141238164) has the molecular formula C8H8O2S and a molecular weight of 168.22 g/mol. Its IUPAC name is 2-methyl-2-thiophen-2-yl-1,3-dioxole.
| Compound Name | 2-methyl-2-thiophen-2-yl-1,3-dioxole |
|---|---|
| PubChem CID | 141238164 |
| Molecular Formula | C8H8O2S |
| Molecular Weight | 168.22 g/mol |
| Exact Mass | 168.02 |
| IUPAC Name | 2-methyl-2-thiophen-2-yl-1,3-dioxole |
| SMILES | CC1(c2cccs2)OC=CO1 |
| InChI | InChI=1S/C8H8O2S/c1-8(9-4-5-10-8)7-3-2-6-11-7/h2-6H,1H3 |
| InChIKey | SYCRTAIPTZLMGE-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.22 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |