C9H11BrO2S — CID 71623753
2-(1-bromoethyl)-2-thiophen-2-yl-1,3-dioxolane (PubChem CID 71623753) has the molecular formula C9H11BrO2S and a molecular weight of 263.16 g/mol. Its IUPAC name is 2-(1-bromoethyl)-2-thiophen-2-yl-1,3-dioxolane.
| Compound Name | 2-(1-bromoethyl)-2-thiophen-2-yl-1,3-dioxolane |
|---|---|
| PubChem CID | 71623753 |
| Molecular Formula | C9H11BrO2S |
| Molecular Weight | 263.16 g/mol |
| Exact Mass | 261.97 |
| IUPAC Name | 2-(1-bromoethyl)-2-thiophen-2-yl-1,3-dioxolane |
| SMILES | CC(Br)C1(c2cccs2)OCCO1 |
| InChI | InChI=1S/C9H11BrO2S/c1-7(10)9(11-4-5-12-9)8-3-2-6-13-8/h2-3,6-7H,4-5H2,1H3 |
| InChIKey | MJZOLYQGSBQPNN-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.16 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|