C14H22S — CID 121406244
2-[1-(2-methylpropyl)cyclohexyl]thiophene (PubChem CID 121406244) has the molecular formula C14H22S and a molecular weight of 222.40 g/mol. Its IUPAC name is 2-[1-(2-methylpropyl)cyclohexyl]thiophene.
| Compound Name | 2-[1-(2-methylpropyl)cyclohexyl]thiophene |
|---|---|
| PubChem CID | 121406244 |
| Molecular Formula | C14H22S |
| Molecular Weight | 222.40 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 2-[1-(2-methylpropyl)cyclohexyl]thiophene |
| SMILES | CC(C)CC1(c2cccs2)CCCCC1 |
| InChI | InChI=1S/C14H22S/c1-12(2)11-14(8-4-3-5-9-14)13-7-6-10-15-13/h6-7,10,12H,3-5,8-9,11H2,1-2H3 |
| InChIKey | FEFHLSKWWXXXLK-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.40 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |