C9H12OS — CID 83682682
(1-thiophen-2-ylcyclobutyl)methanol (PubChem CID 83682682) has the molecular formula C9H12OS and a molecular weight of 168.26 g/mol. Its IUPAC name is (1-thiophen-2-ylcyclobutyl)methanol.
| Compound Name | (1-thiophen-2-ylcyclobutyl)methanol |
|---|---|
| PubChem CID | 83682682 |
| Molecular Formula | C9H12OS |
| Molecular Weight | 168.26 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | (1-thiophen-2-ylcyclobutyl)methanol |
| SMILES | OCC1(c2cccs2)CCC1 |
| InChI | InChI=1S/C9H12OS/c10-7-9(4-2-5-9)8-3-1-6-11-8/h1,3,6,10H,2,4-5,7H2 |
| InChIKey | HQWPCZWFZHAKIU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.26 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |