C10H13NO2S — CID 30522713
methyl N-[(1-thiophen-2-ylcyclopropyl)methyl]carbamate (PubChem CID 30522713) has the molecular formula C10H13NO2S and a molecular weight of 211.29 g/mol. Its IUPAC name is methyl N-[(1-thiophen-2-ylcyclopropyl)methyl]carbamate.
| Compound Name | methyl N-[(1-thiophen-2-ylcyclopropyl)methyl]carbamate |
|---|---|
| PubChem CID | 30522713 |
| Molecular Formula | C10H13NO2S |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | methyl N-[(1-thiophen-2-ylcyclopropyl)methyl]carbamate |
| SMILES | COC(=O)NCC1(c2cccs2)CC1 |
| InChI | InChI=1S/C10H13NO2S/c1-13-9(12)11-7-10(4-5-10)8-3-2-6-14-8/h2-3,6H,4-5,7H2,1H3,(H,11,12) |
| InChIKey | LCRFZEFQBPGKBG-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |