C17H17NOS — CID 71961166
3-phenyl-N-[(1-thiophen-2-ylcyclopropyl)methyl]prop-2-enamide (PubChem CID 71961166) has the molecular formula C17H17NOS and a molecular weight of 283.40 g/mol. Its IUPAC name is 3-phenyl-N-[(1-thiophen-2-ylcyclopropyl)methyl]prop-2-enamide.
| Compound Name | 3-phenyl-N-[(1-thiophen-2-ylcyclopropyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 71961166 |
| Molecular Formula | C17H17NOS |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 3-phenyl-N-[(1-thiophen-2-ylcyclopropyl)methyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccccc1)NCC1(c2cccs2)CC1 |
| InChI | InChI=1S/C17H17NOS/c19-16(9-8-14-5-2-1-3-6-14)18-13-17(10-11-17)15-7-4-12-20-15/h1-9,12H,10-11,13H2,(H,18,19) |
| InChIKey | MZCNJMYRTBCEOE-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|