C18H19NOS — CID 24614536
(E)-N-[(1-phenylcyclobutyl)methyl]-3-thiophen-3-ylprop-2-enamide (PubChem CID 24614536) has the molecular formula C18H19NOS and a molecular weight of 297.42 g/mol. Its IUPAC name is (E)-N-[(1-phenylcyclobutyl)methyl]-3-thiophen-3-ylprop-2-enamide.
| Compound Name | (E)-N-[(1-phenylcyclobutyl)methyl]-3-thiophen-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 24614536 |
| Molecular Formula | C18H19NOS |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | (E)-N-[(1-phenylcyclobutyl)methyl]-3-thiophen-3-ylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccsc1)NCC1(c2ccccc2)CCC1 |
| InChI | InChI=1S/C18H19NOS/c20-17(8-7-15-9-12-21-13-15)19-14-18(10-4-11-18)16-5-2-1-3-6-16/h1-3,5-9,12-13H,4,10-11,14H2,(H,19,20)/b8-7+ |
| InChIKey | JNGYXBUGNPWRSM-BQYQJAHWSA-N |
| XLogP | 4.00 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|