C16H17NO2S — CID 56765287
(E)-N-(2-hydroxy-3-phenylpropyl)-3-thiophen-3-ylprop-2-enamide (PubChem CID 56765287) has the molecular formula C16H17NO2S and a molecular weight of 287.38 g/mol. Its IUPAC name is (E)-N-(2-hydroxy-3-phenylpropyl)-3-thiophen-3-ylprop-2-enamide.
| Compound Name | (E)-N-(2-hydroxy-3-phenylpropyl)-3-thiophen-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 56765287 |
| Molecular Formula | C16H17NO2S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | (E)-N-(2-hydroxy-3-phenylpropyl)-3-thiophen-3-ylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccsc1)NCC(O)Cc1ccccc1 |
| InChI | InChI=1S/C16H17NO2S/c18-15(10-13-4-2-1-3-5-13)11-17-16(19)7-6-14-8-9-20-12-14/h1-9,12,15,18H,10-11H2,(H,17,19)/b7-6+ |
| InChIKey | MESWKABOJFWNSZ-VOTSOKGWSA-N |
| XLogP | 2.48 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|