C22H23NO2 — CID 24614598
(E)-3-(2,3-dihydro-1-benzofuran-5-yl)-N-[(1-phenylcyclobutyl)methyl]prop-2-enamide (PubChem CID 24614598) has the molecular formula C22H23NO2 and a molecular weight of 333.43 g/mol. Its IUPAC name is (E)-3-(2,3-dihydro-1-benzofuran-5-yl)-N-[(1-phenylcyclobutyl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(2,3-dihydro-1-benzofuran-5-yl)-N-[(1-phenylcyclobutyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 24614598 |
| Molecular Formula | C22H23NO2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | (E)-3-(2,3-dihydro-1-benzofuran-5-yl)-N-[(1-phenylcyclobutyl)methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc2c(c1)CCO2)NCC1(c2ccccc2)CCC1 |
| InChI | InChI=1S/C22H23NO2/c24-21(10-8-17-7-9-20-18(15-17)11-14-25-20)23-16-22(12-4-13-22)19-5-2-1-3-6-19/h1-3,5-10,15H,4,11-14,16H2,(H,23,24)/b10-8+ |
| InChIKey | BMRZNRDBKKBVAN-CSKARUKUSA-N |
| XLogP | 3.87 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|