C21H19N3O2 — CID 24617872
(E)-3-(2,3-dihydro-1-benzofuran-5-yl)-N-[(1-phenylpyrazol-4-yl)methyl]prop-2-enamide (PubChem CID 24617872) has the molecular formula C21H19N3O2 and a molecular weight of 345.40 g/mol. Its IUPAC name is (E)-3-(2,3-dihydro-1-benzofuran-5-yl)-N-[(1-phenylpyrazol-4-yl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(2,3-dihydro-1-benzofuran-5-yl)-N-[(1-phenylpyrazol-4-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 24617872 |
| Molecular Formula | C21H19N3O2 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | (E)-3-(2,3-dihydro-1-benzofuran-5-yl)-N-[(1-phenylpyrazol-4-yl)methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc2c(c1)CCO2)NCc1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C21H19N3O2/c25-21(9-7-16-6-8-20-18(12-16)10-11-26-20)22-13-17-14-23-24(15-17)19-4-2-1-3-5-19/h1-9,12,14-15H,10-11,13H2,(H,22,25)/b9-7+ |
| InChIKey | QYFWVCNSZIVUDR-VQHVLOKHSA-N |
| XLogP | 3.14 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|