C24H27N3O3 — CID 55708804
(E)-3-(2,3-dihydro-1-benzofuran-5-yl)-N-[[4-(4-methylpiperazine-1-carbonyl)phenyl]methyl]prop-2-enamide (PubChem CID 55708804) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is (E)-3-(2,3-dihydro-1-benzofuran-5-yl)-N-[[4-(4-methylpiperazine-1-carbonyl)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(2,3-dihydro-1-benzofuran-5-yl)-N-[[4-(4-methylpiperazine-1-carbonyl)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 55708804 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | (E)-3-(2,3-dihydro-1-benzofuran-5-yl)-N-[[4-(4-methylpiperazine-1-carbonyl)phenyl]methyl]prop-2-enamide |
| SMILES | CN1CCN(C(=O)c2ccc(CNC(=O)/C=C/c3ccc4c(c3)CCO4)cc2)CC1 |
| InChI | InChI=1S/C24H27N3O3/c1-26-11-13-27(14-12-26)24(29)20-6-2-19(3-7-20)17-25-23(28)9-5-18-4-8-22-21(16-18)10-15-30-22/h2-9,16H,10-15,17H2,1H3,(H,25,28)/b9-5+ |
| InChIKey | SPSGHWCZYXRADX-WEVVVXLNSA-N |
| XLogP | 2.34 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|