C19H23NO2S — CID 122031530
3-[[(1-thiophen-2-ylcyclohexyl)methylamino]methyl]benzoic acid (PubChem CID 122031530) has the molecular formula C19H23NO2S and a molecular weight of 329.47 g/mol. Its IUPAC name is 3-[[(1-thiophen-2-ylcyclohexyl)methylamino]methyl]benzoic acid.
| Compound Name | 3-[[(1-thiophen-2-ylcyclohexyl)methylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122031530 |
| Molecular Formula | C19H23NO2S |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 3-[[(1-thiophen-2-ylcyclohexyl)methylamino]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CNCC2(c3cccs3)CCCCC2)c1 |
| InChI | InChI=1S/C19H23NO2S/c21-18(22)16-7-4-6-15(12-16)13-20-14-19(9-2-1-3-10-19)17-8-5-11-23-17/h4-8,11-12,20H,1-3,9-10,13-14H2,(H,21,22) |
| InChIKey | SMRBBMQQOLHBDY-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |