C20H31N3O2 — CID 122031653
3-[[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methylamino]methyl]benzoic acid (PubChem CID 122031653) has the molecular formula C20H31N3O2 and a molecular weight of 345.49 g/mol. Its IUPAC name is 3-[[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methylamino]methyl]benzoic acid.
| Compound Name | 3-[[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122031653 |
| Molecular Formula | C20H31N3O2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | 3-[[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methylamino]methyl]benzoic acid |
| SMILES | CN1CCC(CNCc2cccc(C(=O)O)c2)(N2CCCCC2)CC1 |
| InChI | InChI=1S/C20H31N3O2/c1-22-12-8-20(9-13-22,23-10-3-2-4-11-23)16-21-15-17-6-5-7-18(14-17)19(24)25/h5-7,14,21H,2-4,8-13,15-16H2,1H3,(H,24,25) |
| InChIKey | UBVCTBJIJLFUTN-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |