C20H22ClNO2 — CID 122030663
3-[[[1-(4-chlorophenyl)cyclopentyl]methylamino]methyl]benzoic acid (PubChem CID 122030663) has the molecular formula C20H22ClNO2 and a molecular weight of 343.85 g/mol. Its IUPAC name is 3-[[[1-(4-chlorophenyl)cyclopentyl]methylamino]methyl]benzoic acid.
| Compound Name | 3-[[[1-(4-chlorophenyl)cyclopentyl]methylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122030663 |
| Molecular Formula | C20H22ClNO2 |
| Molecular Weight | 343.85 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 3-[[[1-(4-chlorophenyl)cyclopentyl]methylamino]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CNCC2(c3ccc(Cl)cc3)CCCC2)c1 |
| InChI | InChI=1S/C20H22ClNO2/c21-18-8-6-17(7-9-18)20(10-1-2-11-20)14-22-13-15-4-3-5-16(12-15)19(23)24/h3-9,12,22H,1-2,10-11,13-14H2,(H,23,24) |
| InChIKey | FGJINHFUDQAXMG-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.85 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |