C16H23NO3 — CID 122031824
3-[[(2-hydroxy-1-methylcyclohexyl)methylamino]methyl]benzoic acid (PubChem CID 122031824) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is 3-[[(2-hydroxy-1-methylcyclohexyl)methylamino]methyl]benzoic acid.
| Compound Name | 3-[[(2-hydroxy-1-methylcyclohexyl)methylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122031824 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 3-[[(2-hydroxy-1-methylcyclohexyl)methylamino]methyl]benzoic acid |
| SMILES | CC1(CNCc2cccc(C(=O)O)c2)CCCCC1O |
| InChI | InChI=1S/C16H23NO3/c1-16(8-3-2-7-14(16)18)11-17-10-12-5-4-6-13(9-12)15(19)20/h4-6,9,14,17-18H,2-3,7-8,10-11H2,1H3,(H,19,20) |
| InChIKey | XHLOBBMEXFWEND-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |