C21H25NO2S — CID 122031754
3-[[[1-(4-methylphenyl)sulfanylcyclopentyl]methylamino]methyl]benzoic acid (PubChem CID 122031754) has the molecular formula C21H25NO2S and a molecular weight of 355.50 g/mol. Its IUPAC name is 3-[[[1-(4-methylphenyl)sulfanylcyclopentyl]methylamino]methyl]benzoic acid.
| Compound Name | 3-[[[1-(4-methylphenyl)sulfanylcyclopentyl]methylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122031754 |
| Molecular Formula | C21H25NO2S |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 3-[[[1-(4-methylphenyl)sulfanylcyclopentyl]methylamino]methyl]benzoic acid |
| SMILES | Cc1ccc(SC2(CNCc3cccc(C(=O)O)c3)CCCC2)cc1 |
| InChI | InChI=1S/C21H25NO2S/c1-16-7-9-19(10-8-16)25-21(11-2-3-12-21)15-22-14-17-5-4-6-18(13-17)20(23)24/h4-10,13,22H,2-3,11-12,14-15H2,1H3,(H,23,24) |
| InChIKey | KLLBMJKYDMDIGJ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |