C18H17BrClNO2 — CID 122034798
3-[[[1-(4-bromo-2-chlorophenyl)cyclopropyl]methylamino]methyl]benzoic acid (PubChem CID 122034798) has the molecular formula C18H17BrClNO2 and a molecular weight of 394.70 g/mol. Its IUPAC name is 3-[[[1-(4-bromo-2-chlorophenyl)cyclopropyl]methylamino]methyl]benzoic acid.
| Compound Name | 3-[[[1-(4-bromo-2-chlorophenyl)cyclopropyl]methylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122034798 |
| Molecular Formula | C18H17BrClNO2 |
| Molecular Weight | 394.70 g/mol |
| Exact Mass | 393.01 |
| IUPAC Name | 3-[[[1-(4-bromo-2-chlorophenyl)cyclopropyl]methylamino]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CNCC2(c3ccc(Br)cc3Cl)CC2)c1 |
| InChI | InChI=1S/C18H17BrClNO2/c19-14-4-5-15(16(20)9-14)18(6-7-18)11-21-10-12-2-1-3-13(8-12)17(22)23/h1-5,8-9,21H,6-7,10-11H2,(H,22,23) |
| InChIKey | AWMDNGONVSRHTF-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.70 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |