C19H19Cl2NO2 — CID 122032223
4-[[[1-(2,4-dichlorophenyl)cyclobutyl]methylamino]methyl]benzoic acid (PubChem CID 122032223) has the molecular formula C19H19Cl2NO2 and a molecular weight of 364.27 g/mol. Its IUPAC name is 4-[[[1-(2,4-dichlorophenyl)cyclobutyl]methylamino]methyl]benzoic acid.
| Compound Name | 4-[[[1-(2,4-dichlorophenyl)cyclobutyl]methylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122032223 |
| Molecular Formula | C19H19Cl2NO2 |
| Molecular Weight | 364.27 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 4-[[[1-(2,4-dichlorophenyl)cyclobutyl]methylamino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNCC2(c3ccc(Cl)cc3Cl)CCC2)cc1 |
| InChI | InChI=1S/C19H19Cl2NO2/c20-15-6-7-16(17(21)10-15)19(8-1-9-19)12-22-11-13-2-4-14(5-3-13)18(23)24/h2-7,10,22H,1,8-9,11-12H2,(H,23,24) |
| InChIKey | GCHUGPFPLAADAA-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.27 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |