C17H25Cl2N — CID 63517640
N-[[1-(2,4-dichlorophenyl)cycloheptyl]methyl]propan-1-amine (PubChem CID 63517640) has the molecular formula C17H25Cl2N and a molecular weight of 314.30 g/mol. Its IUPAC name is N-[[1-(2,4-dichlorophenyl)cycloheptyl]methyl]propan-1-amine.
| Compound Name | N-[[1-(2,4-dichlorophenyl)cycloheptyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 63517640 |
| Molecular Formula | C17H25Cl2N |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | N-[[1-(2,4-dichlorophenyl)cycloheptyl]methyl]propan-1-amine |
| SMILES | CCCNCC1(c2ccc(Cl)cc2Cl)CCCCCC1 |
| InChI | InChI=1S/C17H25Cl2N/c1-2-11-20-13-17(9-5-3-4-6-10-17)15-8-7-14(18)12-16(15)19/h7-8,12,20H,2-6,9-11,13H2,1H3 |
| InChIKey | NLMNCELTMOUEBV-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|