C12H17NS — CID 62595338
N-[(1-thiophen-2-ylcyclobutyl)methyl]cyclopropanamine (PubChem CID 62595338) has the molecular formula C12H17NS and a molecular weight of 207.34 g/mol. Its IUPAC name is N-[(1-thiophen-2-ylcyclobutyl)methyl]cyclopropanamine.
| Compound Name | N-[(1-thiophen-2-ylcyclobutyl)methyl]cyclopropanamine |
|---|---|
| PubChem CID | 62595338 |
| Molecular Formula | C12H17NS |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | N-[(1-thiophen-2-ylcyclobutyl)methyl]cyclopropanamine |
| SMILES | c1csc(C2(CNC3CC3)CCC2)c1 |
| InChI | InChI=1S/C12H17NS/c1-3-11(14-8-1)12(6-2-7-12)9-13-10-4-5-10/h1,3,8,10,13H,2,4-7,9H2 |
| InChIKey | HYBHHOXRRHFRFN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |