C14H21NO2S — CID 28683986
N-[(1R)-1-thiophen-2-ylethyl]-1,4-dioxaspiro[4.5]decan-8-amine (PubChem CID 28683986) has the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. Its IUPAC name is N-[(1R)-1-thiophen-2-ylethyl]-1,4-dioxaspiro[4.5]decan-8-amine.
| Compound Name | N-[(1R)-1-thiophen-2-ylethyl]-1,4-dioxaspiro[4.5]decan-8-amine |
|---|---|
| PubChem CID | 28683986 |
| Molecular Formula | C14H21NO2S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | N-[(1R)-1-thiophen-2-ylethyl]-1,4-dioxaspiro[4.5]decan-8-amine |
| SMILES | C[C@@H](NC1CCC2(CC1)OCCO2)c1cccs1 |
| InChI | InChI=1S/C14H21NO2S/c1-11(13-3-2-10-18-13)15-12-4-6-14(7-5-12)16-8-9-17-14/h2-3,10-12,15H,4-9H2,1H3/t11-/m1/s1 |
| InChIKey | KLRRIWOHHUFQBM-LLVKDONJSA-N |
| XLogP | 3.08 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |