C10H14O2S — CID 83957583
2-propyl-2-thiophen-2-yl-1,3-dioxolane (PubChem CID 83957583) has the molecular formula C10H14O2S and a molecular weight of 198.29 g/mol. Its IUPAC name is 2-propyl-2-thiophen-2-yl-1,3-dioxolane.
| Compound Name | 2-propyl-2-thiophen-2-yl-1,3-dioxolane |
|---|---|
| PubChem CID | 83957583 |
| Molecular Formula | C10H14O2S |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | 2-propyl-2-thiophen-2-yl-1,3-dioxolane |
| SMILES | CCCC1(c2cccs2)OCCO1 |
| InChI | InChI=1S/C10H14O2S/c1-2-5-10(11-6-7-12-10)9-4-3-8-13-9/h3-4,8H,2,5-7H2,1H3 |
| InChIKey | SSQJZWDYMKPMEZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |