C14H22OS — CID 135017669
1-butyl-3-ethyl-3-thiophen-2-ylcyclobutan-1-ol (PubChem CID 135017669) has the molecular formula C14H22OS and a molecular weight of 238.40 g/mol. Its IUPAC name is 1-butyl-3-ethyl-3-thiophen-2-ylcyclobutan-1-ol.
| Compound Name | 1-butyl-3-ethyl-3-thiophen-2-ylcyclobutan-1-ol |
|---|---|
| PubChem CID | 135017669 |
| Molecular Formula | C14H22OS |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 1-butyl-3-ethyl-3-thiophen-2-ylcyclobutan-1-ol |
| SMILES | CCCCC1(O)CC(CC)(c2cccs2)C1 |
| InChI | InChI=1S/C14H22OS/c1-3-5-8-14(15)10-13(4-2,11-14)12-7-6-9-16-12/h6-7,9,15H,3-5,8,10-11H2,1-2H3 |
| InChIKey | YAOFLGQRLJAMOC-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |