C13H19NOS — CID 110698469
N-butyl-N-methyl-1-thiophen-2-ylcyclopropane-1-carboxamide (PubChem CID 110698469) has the molecular formula C13H19NOS and a molecular weight of 237.37 g/mol. Its IUPAC name is N-butyl-N-methyl-1-thiophen-2-ylcyclopropane-1-carboxamide.
| Compound Name | N-butyl-N-methyl-1-thiophen-2-ylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 110698469 |
| Molecular Formula | C13H19NOS |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | N-butyl-N-methyl-1-thiophen-2-ylcyclopropane-1-carboxamide |
| SMILES | CCCCN(C)C(=O)C1(c2cccs2)CC1 |
| InChI | InChI=1S/C13H19NOS/c1-3-4-9-14(2)12(15)13(7-8-13)11-6-5-10-16-11/h5-6,10H,3-4,7-9H2,1-2H3 |
| InChIKey | FMVHLBVLASUVMY-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |