C23H39NOSSi — CID 131729991
4-(dimethylamino)-4-thiophen-2-yl-1-(5-triethylsilylpent-4-ynyl)cyclohexan-1-ol (PubChem CID 131729991) has the molecular formula C23H39NOSSi and a molecular weight of 405.72 g/mol. Its IUPAC name is 4-(dimethylamino)-4-thiophen-2-yl-1-(5-triethylsilylpent-4-ynyl)cyclohexan-1-ol.
| Compound Name | 4-(dimethylamino)-4-thiophen-2-yl-1-(5-triethylsilylpent-4-ynyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 131729991 |
| Molecular Formula | C23H39NOSSi |
| Molecular Weight | 405.72 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | 4-(dimethylamino)-4-thiophen-2-yl-1-(5-triethylsilylpent-4-ynyl)cyclohexan-1-ol |
| SMILES | CC[Si](C#CCCCC1(O)CCC(c2cccs2)(N(C)C)CC1)(CC)CC |
| InChI | InChI=1S/C23H39NOSSi/c1-6-27(7-2,8-3)20-11-9-10-14-22(25)15-17-23(18-16-22,24(4)5)21-13-12-19-26-21/h12-13,19,25H,6-10,14-18H2,1-5H3 |
| InChIKey | YVSPKQDCVRNDKY-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.72 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|