C21H27N3OS — CID 118666594
8-(dimethylamino)-2-(pyridin-4-ylmethyl)-8-thiophen-2-yl-2-azaspiro[4.5]decan-1-one (PubChem CID 118666594) has the molecular formula C21H27N3OS and a molecular weight of 369.53 g/mol. Its IUPAC name is 8-(dimethylamino)-2-(pyridin-4-ylmethyl)-8-thiophen-2-yl-2-azaspiro[4.5]decan-1-one.
| Compound Name | 8-(dimethylamino)-2-(pyridin-4-ylmethyl)-8-thiophen-2-yl-2-azaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 118666594 |
| Molecular Formula | C21H27N3OS |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 8-(dimethylamino)-2-(pyridin-4-ylmethyl)-8-thiophen-2-yl-2-azaspiro[4.5]decan-1-one |
| SMILES | CN(C)C1(c2cccs2)CCC2(CCN(Cc3ccncc3)C2=O)CC1 |
| InChI | InChI=1S/C21H27N3OS/c1-23(2)21(18-4-3-15-26-18)9-7-20(8-10-21)11-14-24(19(20)25)16-17-5-12-22-13-6-17/h3-6,12-13,15H,7-11,14,16H2,1-2H3 |
| InChIKey | QPSRADZTKLGSAY-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |