C9H12O2S — CID 140537757
2-methyl-2-thiophen-2-yl-1,4-dioxane (PubChem CID 140537757) has the molecular formula C9H12O2S and a molecular weight of 184.26 g/mol. Its IUPAC name is 2-methyl-2-thiophen-2-yl-1,4-dioxane.
| Compound Name | 2-methyl-2-thiophen-2-yl-1,4-dioxane |
|---|---|
| PubChem CID | 140537757 |
| Molecular Formula | C9H12O2S |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | 2-methyl-2-thiophen-2-yl-1,4-dioxane |
| SMILES | CC1(c2cccs2)COCCO1 |
| InChI | InChI=1S/C9H12O2S/c1-9(7-10-4-5-11-9)8-3-2-6-12-8/h2-3,6H,4-5,7H2,1H3 |
| InChIKey | KRAOUWVLNIFQRV-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |