C10H12O4S — CID 117169372
2-(2-methyl-2-thiophen-2-yl-1,3-dioxolan-4-yl)acetic acid (PubChem CID 117169372) has the molecular formula C10H12O4S and a molecular weight of 228.27 g/mol. Its IUPAC name is 2-(2-methyl-2-thiophen-2-yl-1,3-dioxolan-4-yl)acetic acid.
| Compound Name | 2-(2-methyl-2-thiophen-2-yl-1,3-dioxolan-4-yl)acetic acid |
|---|---|
| PubChem CID | 117169372 |
| Molecular Formula | C10H12O4S |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | 2-(2-methyl-2-thiophen-2-yl-1,3-dioxolan-4-yl)acetic acid |
| SMILES | CC1(c2cccs2)OCC(CC(=O)O)O1 |
| InChI | InChI=1S/C10H12O4S/c1-10(8-3-2-4-15-8)13-6-7(14-10)5-9(11)12/h2-4,7H,5-6H2,1H3,(H,11,12) |
| InChIKey | KSJODYXVYLOQEX-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |