C12H20O4 — CID 117170091
2-(2-cyclohexyl-2-methyl-1,3-dioxolan-4-yl)acetic acid (PubChem CID 117170091) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is 2-(2-cyclohexyl-2-methyl-1,3-dioxolan-4-yl)acetic acid.
| Compound Name | 2-(2-cyclohexyl-2-methyl-1,3-dioxolan-4-yl)acetic acid |
|---|---|
| PubChem CID | 117170091 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 2-(2-cyclohexyl-2-methyl-1,3-dioxolan-4-yl)acetic acid |
| SMILES | CC1(C2CCCCC2)OCC(CC(=O)O)O1 |
| InChI | InChI=1S/C12H20O4/c1-12(9-5-3-2-4-6-9)15-8-10(16-12)7-11(13)14/h9-10H,2-8H2,1H3,(H,13,14) |
| InChIKey | ZCSHWWJAGGQETG-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |