C12H23NO2 — CID 117170087
2-(2-cyclohexyl-2-methyl-1,3-dioxolan-4-yl)ethanamine (PubChem CID 117170087) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is 2-(2-cyclohexyl-2-methyl-1,3-dioxolan-4-yl)ethanamine.
| Compound Name | 2-(2-cyclohexyl-2-methyl-1,3-dioxolan-4-yl)ethanamine |
|---|---|
| PubChem CID | 117170087 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | 2-(2-cyclohexyl-2-methyl-1,3-dioxolan-4-yl)ethanamine |
| SMILES | CC1(C2CCCCC2)OCC(CCN)O1 |
| InChI | InChI=1S/C12H23NO2/c1-12(10-5-3-2-4-6-10)14-9-11(15-12)7-8-13/h10-11H,2-9,13H2,1H3 |
| InChIKey | ZXQCSOLDIZQGNC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |