C10H19NO3 — CID 117169010
[2-methyl-2-(oxan-2-yl)-1,3-dioxolan-4-yl]methanamine (PubChem CID 117169010) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is [2-methyl-2-(oxan-2-yl)-1,3-dioxolan-4-yl]methanamine.
| Compound Name | [2-methyl-2-(oxan-2-yl)-1,3-dioxolan-4-yl]methanamine |
|---|---|
| PubChem CID | 117169010 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | [2-methyl-2-(oxan-2-yl)-1,3-dioxolan-4-yl]methanamine |
| SMILES | CC1(C2CCCCO2)OCC(CN)O1 |
| InChI | InChI=1S/C10H19NO3/c1-10(9-4-2-3-5-12-9)13-7-8(6-11)14-10/h8-9H,2-7,11H2,1H3 |
| InChIKey | QRANKNGJNFAXFK-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |