About (2-cyclopropyl-2-ethyl-1,3-dioxolan-4-yl)methanamine
(2-cyclopropyl-2-ethyl-1,3-dioxolan-4-yl)methanamine (PubChem CID 82776626) has the molecular formula C9H17NO2
and a molecular weight of 171.24 g/mol. Its IUPAC name is (2-cyclopropyl-2-ethyl-1,3-dioxolan-4-yl)methanamine.
Analyze (2-cyclopropyl-2-ethyl-1,3-dioxolan-4-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-cyclopropyl-2-ethyl-1,3-dioxolan-4-yl)methanamine?
The IUPAC name of (2-cyclopropyl-2-ethyl-1,3-dioxolan-4-yl)methanamine (CID 82776626) is (2-cyclopropyl-2-ethyl-1,3-dioxolan-4-yl)methanamine.
What is the SMILES notation for (2-cyclopropyl-2-ethyl-1,3-dioxolan-4-yl)methanamine?
The canonical SMILES for (2-cyclopropyl-2-ethyl-1,3-dioxolan-4-yl)methanamine is CCC1(C2CC2)OCC(CN)O1.
What is the InChIKey of (2-cyclopropyl-2-ethyl-1,3-dioxolan-4-yl)methanamine?
The InChIKey is CJKMPZXTOMGYMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2/c1-2-9(7-3-4-7)11-6-8(5-10)12-9/h7-8H,2-6,10H2,1H3.
What are the key properties of (2-cyclopropyl-2-ethyl-1,3-dioxolan-4-yl)methanamine?
(2-cyclopropyl-2-ethyl-1,3-dioxolan-4-yl)methanamine has a molecular weight of 171.24 g/mol, XLogP of 0.88, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyclopropyl-2-ethyl-1,3-dioxolan-4-yl)methanamine is sourced from PubChem (CID 82776626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).