C11H21NO2 — CID 82777122
(8-methyl-1,4-dioxaspiro[4.6]undecan-3-yl)methanamine (PubChem CID 82777122) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is (8-methyl-1,4-dioxaspiro[4.6]undecan-3-yl)methanamine.
| Compound Name | (8-methyl-1,4-dioxaspiro[4.6]undecan-3-yl)methanamine |
|---|---|
| PubChem CID | 82777122 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | (8-methyl-1,4-dioxaspiro[4.6]undecan-3-yl)methanamine |
| SMILES | CC1CCCC2(CC1)OCC(CN)O2 |
| InChI | InChI=1S/C11H21NO2/c1-9-3-2-5-11(6-4-9)13-8-10(7-12)14-11/h9-10H,2-8,12H2,1H3 |
| InChIKey | AOVMFIDFMLTSMA-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |