C11H20O3S — CID 117168937
2-[2-methyl-2-(thian-2-yl)-1,3-dioxolan-4-yl]ethanol (PubChem CID 117168937) has the molecular formula C11H20O3S and a molecular weight of 232.34 g/mol. Its IUPAC name is 2-[2-methyl-2-(thian-2-yl)-1,3-dioxolan-4-yl]ethanol.
| Compound Name | 2-[2-methyl-2-(thian-2-yl)-1,3-dioxolan-4-yl]ethanol |
|---|---|
| PubChem CID | 117168937 |
| Molecular Formula | C11H20O3S |
| Molecular Weight | 232.34 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 2-[2-methyl-2-(thian-2-yl)-1,3-dioxolan-4-yl]ethanol |
| SMILES | CC1(C2CCCCS2)OCC(CCO)O1 |
| InChI | InChI=1S/C11H20O3S/c1-11(10-4-2-3-7-15-10)13-8-9(14-11)5-6-12/h9-10,12H,2-8H2,1H3 |
| InChIKey | RKWFVISAKXYIFB-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |