C10H18O2S2 — CID 11053597
4-(1,3-dithian-2-ylmethyl)-2,2-dimethyl-1,3-dioxolane (PubChem CID 11053597) has the molecular formula C10H18O2S2 and a molecular weight of 234.39 g/mol. Its IUPAC name is 4-(1,3-dithian-2-ylmethyl)-2,2-dimethyl-1,3-dioxolane.
| Compound Name | 4-(1,3-dithian-2-ylmethyl)-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 11053597 |
| Molecular Formula | C10H18O2S2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 4-(1,3-dithian-2-ylmethyl)-2,2-dimethyl-1,3-dioxolane |
| SMILES | CC1(C)OCC(CC2SCCCS2)O1 |
| InChI | InChI=1S/C10H18O2S2/c1-10(2)11-7-8(12-10)6-9-13-4-3-5-14-9/h8-9H,3-7H2,1-2H3 |
| InChIKey | XZVZZXNRPHBMHK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |