C14H20O6 — CID 45101837
8-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-6,10-dioxaspiro[4.5]decane-7,9-dione (PubChem CID 45101837) has the molecular formula C14H20O6 and a molecular weight of 284.31 g/mol. Its IUPAC name is 8-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-6,10-dioxaspiro[4.5]decane-7,9-dione.
| Compound Name | 8-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-6,10-dioxaspiro[4.5]decane-7,9-dione |
|---|---|
| PubChem CID | 45101837 |
| Molecular Formula | C14H20O6 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 8-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-6,10-dioxaspiro[4.5]decane-7,9-dione |
| SMILES | CC1(C)OC[C@H](CC2C(=O)OC3(CCCC3)OC2=O)O1 |
| InChI | InChI=1S/C14H20O6/c1-13(2)17-8-9(18-13)7-10-11(15)19-14(20-12(10)16)5-3-4-6-14/h9-10H,3-8H2,1-2H3/t9-/m0/s1 |
| InChIKey | MTASTNZNPJSWJY-VIFPVBQESA-N |
| XLogP | 1.51 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|