C15H20O4 — CID 45101834
(7aR)-7a-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,3,6,7-tetrahydroindene-1,5-dione (PubChem CID 45101834) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is (7aR)-7a-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,3,6,7-tetrahydroindene-1,5-dione.
| Compound Name | (7aR)-7a-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,3,6,7-tetrahydroindene-1,5-dione |
|---|---|
| PubChem CID | 45101834 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | (7aR)-7a-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,3,6,7-tetrahydroindene-1,5-dione |
| SMILES | CC1(C)OC[C@H](C[C@]23CCC(=O)C=C2CCC3=O)O1 |
| InChI | InChI=1S/C15H20O4/c1-14(2)18-9-12(19-14)8-15-6-5-11(16)7-10(15)3-4-13(15)17/h7,12H,3-6,8-9H2,1-2H3/t12-,15+/m0/s1 |
| InChIKey | WSACWCWZBQHSCD-SWLSCSKDSA-N |
| XLogP | 2.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |