C24H33O4P — CID 145039301
(2,2-dimethyl-1,3-dioxolan-4-yl)methyl-bis(4-methoxy-2,6-dimethylphenyl)phosphane (PubChem CID 145039301) has the molecular formula C24H33O4P and a molecular weight of 416.50 g/mol. Its IUPAC name is (2,2-dimethyl-1,3-dioxolan-4-yl)methyl-bis(4-methoxy-2,6-dimethylphenyl)phosphane.
| Compound Name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl-bis(4-methoxy-2,6-dimethylphenyl)phosphane |
|---|---|
| PubChem CID | 145039301 |
| Molecular Formula | C24H33O4P |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl-bis(4-methoxy-2,6-dimethylphenyl)phosphane |
| SMILES | COc1cc(C)c(P(CC2COC(C)(C)O2)c2c(C)cc(OC)cc2C)c(C)c1 |
| InChI | InChI=1S/C24H33O4P/c1-15-9-19(25-7)10-16(2)22(15)29(14-21-13-27-24(5,6)28-21)23-17(3)11-20(26-8)12-18(23)4/h9-12,21H,13-14H2,1-8H3 |
| InChIKey | OPHDFJFUZYAVNO-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|