C41H58O4P2 — CID 145039307
(2,2-dimethyl-1,3-dioxolan-4-yl)methyl-bis(4-methoxy-2,6-dimethylphenyl)phosphane;methyl-[(2Z,4Z)-4-methylhexa-2,4-dien-3-yl]-(2,4,6-trimethylphenyl)phosphane (PubChem CID 145039307) has the molecular formula C41H58O4P2 and a molecular weight of 676.86 g/mol. Its IUPAC name is (2,2-dimethyl-1,3-dioxolan-4-yl)methyl-bis(4-methoxy-2,6-dimethylphenyl)phosphane;methyl-[(2Z,4Z)-4-methylhexa-2,4-dien-3-yl]-(2,4,6-trimethylphenyl)phosphane.
| Compound Name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl-bis(4-methoxy-2,6-dimethylphenyl)phosphane;methyl-[(2Z,4Z)-4-methylhexa-2,4-dien-3-yl]-(2,4,6-trimethylphenyl)phosphane |
|---|---|
| PubChem CID | 145039307 |
| Molecular Formula | C41H58O4P2 |
| Molecular Weight | 676.86 g/mol |
| Exact Mass | 676.38 |
| IUPAC Name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl-bis(4-methoxy-2,6-dimethylphenyl)phosphane;methyl-[(2Z,4Z)-4-methylhexa-2,4-dien-3-yl]-(2,4,6-trimethylphenyl)phosphane |
| SMILES | C/C=C(C)\C(=C\C)P(C)c1c(C)cc(C)cc1C.COc1cc(C)c(P(CC2COC(C)(C)O2)c2c(C)cc(OC)cc2C)c(C)c1 |
| InChI | InChI=1S/C24H33O4P.C17H25P/c1-15-9-19(25-7)10-16(2)22(15)29(14-21-13-27-24(5,6)28-21)23-17(3)11-20(26-8)12-18(23)4;1-8-13(4)16(9-2)18(7)17-14(5)10-12(3)11-15(17)6/h9-12,21H,13-14H2,1-8H3;8-11H,1-7H3/b;13-8-,16-9- |
| InChIKey | TVKZCSGFPLTRHK-NFIHPTCRSA-N |
| XLogP | 9.74 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.86 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|