C17H25P — CID 145039308
methyl-[(2Z,4Z)-4-methylhexa-2,4-dien-3-yl]-(2,4,6-trimethylphenyl)phosphane (PubChem CID 145039308) has the molecular formula C17H25P and a molecular weight of 260.36 g/mol. Its IUPAC name is methyl-[(2Z,4Z)-4-methylhexa-2,4-dien-3-yl]-(2,4,6-trimethylphenyl)phosphane.
| Compound Name | methyl-[(2Z,4Z)-4-methylhexa-2,4-dien-3-yl]-(2,4,6-trimethylphenyl)phosphane |
|---|---|
| PubChem CID | 145039308 |
| Molecular Formula | C17H25P |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | methyl-[(2Z,4Z)-4-methylhexa-2,4-dien-3-yl]-(2,4,6-trimethylphenyl)phosphane |
| SMILES | C/C=C(C)\C(=C\C)P(C)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C17H25P/c1-8-13(4)16(9-2)18(7)17-14(5)10-12(3)11-15(17)6/h8-11H,1-7H3/b13-8-,16-9- |
| InChIKey | ZJJGDCSIGBLWRS-JNERDLNJSA-N |
| XLogP | 5.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|