C18H19Cl2O2P — CID 145039317
bis(4-chlorophenyl)-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]phosphane (PubChem CID 145039317) has the molecular formula C18H19Cl2O2P and a molecular weight of 369.23 g/mol. Its IUPAC name is bis(4-chlorophenyl)-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]phosphane.
| Compound Name | bis(4-chlorophenyl)-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]phosphane |
|---|---|
| PubChem CID | 145039317 |
| Molecular Formula | C18H19Cl2O2P |
| Molecular Weight | 369.23 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | bis(4-chlorophenyl)-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]phosphane |
| SMILES | CC1(C)OCC(CP(c2ccc(Cl)cc2)c2ccc(Cl)cc2)O1 |
| InChI | InChI=1S/C18H19Cl2O2P/c1-18(2)21-11-15(22-18)12-23(16-7-3-13(19)4-8-16)17-9-5-14(20)6-10-17/h3-10,15H,11-12H2,1-2H3 |
| InChIKey | KLEMKDDVRKPCNC-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.23 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|