C25H28BrO2P — CID 11059758
2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl-triphenylphosphanium bromide (PubChem CID 11059758) has the molecular formula C25H28BrO2P and a molecular weight of 471.38 g/mol. Its IUPAC name is 2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl-triphenylphosphanium bromide.
| Compound Name | 2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl-triphenylphosphanium bromide |
|---|---|
| PubChem CID | 11059758 |
| Molecular Formula | C25H28BrO2P |
| Molecular Weight | 471.38 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | 2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl-triphenylphosphanium bromide |
| SMILES | CC1(C)OC[C@@H](CC[P+](c2ccccc2)(c2ccccc2)c2ccccc2)O1.[Br-] |
| InChI | InChI=1S/C25H28O2P.BrH/c1-25(2)26-20-21(27-25)18-19-28(22-12-6-3-7-13-22,23-14-8-4-9-15-23)24-16-10-5-11-17-24;/h3-17,21H,18-20H2,1-2H3;1H/q+1;/p-1/t21-;/m1./s1 |
| InChIKey | WMOUFJBFBMKEKV-ZMBIFBSDSA-M |
| XLogP | 1.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.38 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|