C13H16O4 — CID 71662878
[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl benzoate (PubChem CID 71662878) has the molecular formula C13H16O4 and a molecular weight of 240.27 g/mol. Its IUPAC name is [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl benzoate.
| Compound Name | [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl benzoate |
|---|---|
| PubChem CID | 71662878 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl benzoate |
| SMILES | CC1(C)OC[C@@H](C[18O]C(=[18O])c2ccccc2)O1 |
| InChI | InChI=1S/C13H16O4/c1-13(2)16-9-11(17-13)8-15-12(14)10-6-4-3-5-7-10/h3-7,11H,8-9H2,1-2H3/t11-/m1/s1/i14+2,15+2 |
| InChIKey | YOMCVAULZUXXDS-VGKSBKMBSA-N |
| XLogP | 1.99 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |