C13H18NO3- — CID 100917658
N-benzyl-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-N-oxidomethanamine (PubChem CID 100917658) has the molecular formula C13H18NO3- and a molecular weight of 236.29 g/mol. Its IUPAC name is N-benzyl-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-N-oxidomethanamine.
| Compound Name | N-benzyl-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-N-oxidomethanamine |
|---|---|
| PubChem CID | 100917658 |
| Molecular Formula | C13H18NO3- |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | N-benzyl-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-N-oxidomethanamine |
| SMILES | CC1(C)OC[C@H](CN([O-])Cc2ccccc2)O1 |
| InChI | InChI=1S/C13H18NO3/c1-13(2)16-10-12(17-13)9-14(15)8-11-6-4-3-5-7-11/h3-7,12H,8-10H2,1-2H3/q-1/t12-/m0/s1 |
| InChIKey | DDKLIKSCCDEGHS-LBPRGKRZSA-N |
| XLogP | 2.14 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|