C13H17NO3 — CID 42642786
N-benzyl-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methanimine oxide (PubChem CID 42642786) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is N-benzyl-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methanimine oxide.
| Compound Name | N-benzyl-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methanimine oxide |
|---|---|
| PubChem CID | 42642786 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | N-benzyl-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methanimine oxide |
| SMILES | CC1(C)OC[C@H](/C=[N+](/[O-])Cc2ccccc2)O1 |
| InChI | InChI=1S/C13H17NO3/c1-13(2)16-10-12(17-13)9-14(15)8-11-6-4-3-5-7-11/h3-7,9,12H,8,10H2,1-2H3/b14-9+/t12-/m0/s1 |
| InChIKey | SBWVZNCDVKIVPK-IGVUGNCQSA-N |
| XLogP | 1.92 |
| TPSA | 44.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|